From 0df1312357ce31131092fbe39a0c623eade4ed7f Mon Sep 17 00:00:00 2001 From: David Zeuthen Date: Thu, 7 Jan 2021 17:26:32 -0500 Subject: Identity Credential: API changes for Android 12 - Add PackageManager system features (with versions) for the normal and direct access store - Deprecate IdentityCredentialStore.deleteCredentialByName() and add IdentityCredential.delete() as a replacement. - Add IdentityCredential.proveOwnership() - Add IdentityCredential.update() - Add docs for ProofOfBinding CBOR in X.509 extension of certificate for AuthenticationKey - Add IdentityCredential.setAllowUsingExpiredKeys() - Add version of IdentityCredential.storeStaticAuthenticationData() which takes a an expiration date. Deprecate the old variant of this method. Bug: 170146643 Test: atest android.security.identity.cts Change-Id: I39a0ed65ed6efaa424ada7a9495e3b1da67cf452 --- .../identity/CredstoreIdentityCredential.java | 86 +++++++++++- .../identity/CredstoreIdentityCredentialStore.java | 1 - .../CredstoreWritableIdentityCredential.java | 10 +- .../security/identity/IdentityCredential.java | 155 +++++++++++++++++++++ .../security/identity/IdentityCredentialStore.java | 14 +- 5 files changed, 260 insertions(+), 6 deletions(-) (limited to 'identity/java') diff --git a/identity/java/android/security/identity/CredstoreIdentityCredential.java b/identity/java/android/security/identity/CredstoreIdentityCredential.java index 7c0af6def696..6398cee74cba 100644 --- a/identity/java/android/security/identity/CredstoreIdentityCredential.java +++ b/identity/java/android/security/identity/CredstoreIdentityCredential.java @@ -37,6 +37,7 @@ import java.security.cert.CertificateEncodingException; import java.security.cert.CertificateException; import java.security.cert.CertificateFactory; import java.security.cert.X509Certificate; +import java.time.Instant; import java.util.Collection; import java.util.LinkedList; import java.util.Map; @@ -237,12 +238,18 @@ class CredstoreIdentityCredential extends IdentityCredential { } private boolean mAllowUsingExhaustedKeys = true; + private boolean mAllowUsingExpiredKeys = false; @Override public void setAllowUsingExhaustedKeys(boolean allowUsingExhaustedKeys) { mAllowUsingExhaustedKeys = allowUsingExhaustedKeys; } + @Override + public void setAllowUsingExpiredKeys(boolean allowUsingExpiredKeys) { + mAllowUsingExpiredKeys = allowUsingExpiredKeys; + } + private boolean mOperationHandleSet = false; private long mOperationHandle = 0; @@ -256,7 +263,8 @@ class CredstoreIdentityCredential extends IdentityCredential { public long getCredstoreOperationHandle() { if (!mOperationHandleSet) { try { - mOperationHandle = mBinder.selectAuthKey(mAllowUsingExhaustedKeys); + mOperationHandle = mBinder.selectAuthKey(mAllowUsingExhaustedKeys, + mAllowUsingExpiredKeys); mOperationHandleSet = true; } catch (android.os.RemoteException e) { throw new RuntimeException("Unexpected RemoteException ", e); @@ -306,7 +314,8 @@ class CredstoreIdentityCredential extends IdentityCredential { rnsParcels, sessionTranscript != null ? sessionTranscript : new byte[0], readerSignature != null ? readerSignature : new byte[0], - mAllowUsingExhaustedKeys); + mAllowUsingExhaustedKeys, + mAllowUsingExpiredKeys); } catch (android.os.RemoteException e) { throw new RuntimeException("Unexpected RemoteException ", e); } catch (android.os.ServiceSpecificException e) { @@ -409,6 +418,34 @@ class CredstoreIdentityCredential extends IdentityCredential { } } + @Override + public void storeStaticAuthenticationData(X509Certificate authenticationKey, + Instant expirationDate, + byte[] staticAuthData) + throws UnknownAuthenticationKeyException { + try { + AuthKeyParcel authKeyParcel = new AuthKeyParcel(); + authKeyParcel.x509cert = authenticationKey.getEncoded(); + long millisSinceEpoch = (expirationDate.getEpochSecond() * 1000) + + (expirationDate.getNano() / 1000000); + mBinder.storeStaticAuthenticationDataWithExpiration(authKeyParcel, + millisSinceEpoch, staticAuthData); + } catch (CertificateEncodingException e) { + throw new RuntimeException("Error encoding authenticationKey", e); + } catch (android.os.RemoteException e) { + throw new RuntimeException("Unexpected RemoteException ", e); + } catch (android.os.ServiceSpecificException e) { + if (e.errorCode == ICredentialStore.ERROR_NOT_SUPPORTED) { + throw new UnsupportedOperationException("Not supported", e); + } else if (e.errorCode == ICredentialStore.ERROR_AUTHENTICATION_KEY_NOT_FOUND) { + throw new UnknownAuthenticationKeyException(e.getMessage(), e); + } else { + throw new RuntimeException("Unexpected ServiceSpecificException with code " + + e.errorCode, e); + } + } + } + @Override public @NonNull int[] getAuthenticationDataUsageCount() { try { @@ -421,4 +458,49 @@ class CredstoreIdentityCredential extends IdentityCredential { + e.errorCode, e); } } + + @Override + public @NonNull byte[] proveOwnership(@NonNull byte[] challenge) { + try { + byte[] proofOfOwnership = mBinder.proveOwnership(challenge); + return proofOfOwnership; + } catch (android.os.RemoteException e) { + throw new RuntimeException("Unexpected RemoteException ", e); + } catch (android.os.ServiceSpecificException e) { + if (e.errorCode == ICredentialStore.ERROR_NOT_SUPPORTED) { + throw new UnsupportedOperationException("Not supported", e); + } else { + throw new RuntimeException("Unexpected ServiceSpecificException with code " + + e.errorCode, e); + } + } + } + + @Override + public @NonNull byte[] delete(@NonNull byte[] challenge) { + try { + byte[] proofOfDeletion = mBinder.deleteWithChallenge(challenge); + return proofOfDeletion; + } catch (android.os.RemoteException e) { + throw new RuntimeException("Unexpected RemoteException ", e); + } catch (android.os.ServiceSpecificException e) { + throw new RuntimeException("Unexpected ServiceSpecificException with code " + + e.errorCode, e); + } + } + + @Override + public @NonNull byte[] update(@NonNull PersonalizationData personalizationData) { + try { + IWritableCredential binder = mBinder.update(); + byte[] proofOfProvision = + CredstoreWritableIdentityCredential.personalize(binder, personalizationData); + return proofOfProvision; + } catch (android.os.RemoteException e) { + throw new RuntimeException("Unexpected RemoteException ", e); + } catch (android.os.ServiceSpecificException e) { + throw new RuntimeException("Unexpected ServiceSpecificException with code " + + e.errorCode, e); + } + } } diff --git a/identity/java/android/security/identity/CredstoreIdentityCredentialStore.java b/identity/java/android/security/identity/CredstoreIdentityCredentialStore.java index 129063361b35..d8d47424e2e8 100644 --- a/identity/java/android/security/identity/CredstoreIdentityCredentialStore.java +++ b/identity/java/android/security/identity/CredstoreIdentityCredentialStore.java @@ -162,5 +162,4 @@ class CredstoreIdentityCredentialStore extends IdentityCredentialStore { + e.errorCode, e); } } - } diff --git a/identity/java/android/security/identity/CredstoreWritableIdentityCredential.java b/identity/java/android/security/identity/CredstoreWritableIdentityCredential.java index 725e3d8e429a..d2e7984ce19f 100644 --- a/identity/java/android/security/identity/CredstoreWritableIdentityCredential.java +++ b/identity/java/android/security/identity/CredstoreWritableIdentityCredential.java @@ -76,7 +76,14 @@ class CredstoreWritableIdentityCredential extends WritableIdentityCredential { @NonNull @Override public byte[] personalize(@NonNull PersonalizationData personalizationData) { + return personalize(mBinder, personalizationData); + } + // Used by both personalize() and CredstoreIdentityCredential.update(). + // + @NonNull + static byte[] personalize(IWritableCredential binder, + @NonNull PersonalizationData personalizationData) { Collection accessControlProfiles = personalizationData.getAccessControlProfiles(); @@ -144,7 +151,7 @@ class CredstoreWritableIdentityCredential extends WritableIdentityCredential { secureUserId = getRootSid(); } try { - byte[] personalizationReceipt = mBinder.personalize(acpParcels, ensParcels, + byte[] personalizationReceipt = binder.personalize(acpParcels, ensParcels, secureUserId); return personalizationReceipt; } catch (android.os.RemoteException e) { @@ -164,5 +171,4 @@ class CredstoreWritableIdentityCredential extends WritableIdentityCredential { return rootSid; } - } diff --git a/identity/java/android/security/identity/IdentityCredential.java b/identity/java/android/security/identity/IdentityCredential.java index 4eb6e420c07f..8f175bb63edb 100644 --- a/identity/java/android/security/identity/IdentityCredential.java +++ b/identity/java/android/security/identity/IdentityCredential.java @@ -23,6 +23,7 @@ import java.security.InvalidKeyException; import java.security.KeyPair; import java.security.PublicKey; import java.security.cert.X509Certificate; +import java.time.Instant; import java.util.Collection; import java.util.Map; @@ -113,6 +114,25 @@ public abstract class IdentityCredential { */ public abstract void setAllowUsingExhaustedKeys(boolean allowUsingExhaustedKeys); + /** + * Sets whether to allow using an authentication key which has been expired if no + * other key is available. This must be called prior to calling + * {@link #getEntries(byte[], Map, byte[], byte[])}. + * + *

By default this is set to false. + * + *

This is only implemented in feature version 202101 or later. If not implemented, the call + * fails with {@link UnsupportedOperationException}. See + * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known + * feature versions. + * + * @param allowUsingExpiredKeys whether to allow using an authentication key which use count + * has been exceeded if no other key is available. + */ + public void setAllowUsingExpiredKeys(boolean allowUsingExpiredKeys) { + throw new UnsupportedOperationException(); + } + /** * Called by android.hardware.biometrics.CryptoObject#getOpId() to get an * operation handle. @@ -289,6 +309,21 @@ public abstract class IdentityCredential { * *

Each X.509 certificate is signed by CredentialKey. The certificate chain for CredentialKey * can be obtained using the {@link #getCredentialKeyCertificateChain()} method. + + *

If the implementation is feature version 202101 or later, + * each X.509 certificate contains an X.509 extension at OID 1.3.6.1.4.1.11129.2.1.26 which + * contains a DER encoded OCTET STRING with the bytes of the CBOR with the following CDDL: + *

+     *   ProofOfBinding = [
+     *     "ProofOfBinding",
+     *     bstr,              // Contains SHA-256(ProofOfProvisioning)
+     *   ]
+     * 
+ *

This CBOR enables an issuer to determine the exact state of the credential it + * returns issuer-signed data for. + * + *

See {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for + * known feature versions. * * @return A collection of X.509 certificates for dynamic authentication keys that need issuer * certification. @@ -308,16 +343,136 @@ public abstract class IdentityCredential { * the authenticity * and integrity of the credential data fields. * @throws UnknownAuthenticationKeyException If the given authentication key is not recognized. + * @deprecated Use {@link #storeStaticAuthenticationData(X509Certificate, Instant, byte[])} + * instead. */ + @Deprecated public abstract void storeStaticAuthenticationData( @NonNull X509Certificate authenticationKey, @NonNull byte[] staticAuthData) throws UnknownAuthenticationKeyException; + /** + * Store authentication data associated with a dynamic authentication key. + * + * This should only be called for an authenticated key returned by + * {@link #getAuthKeysNeedingCertification()}. + * + *

This is only implemented in feature version 202101 or later. If not implemented, the call + * fails with {@link UnsupportedOperationException}. See + * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known + * feature versions. + * + * @param authenticationKey The dynamic authentication key for which certification and + * associated static + * authentication data is being provided. + * @param expirationDate The expiration date of the static authentication data. + * @param staticAuthData Static authentication data provided by the issuer that validates + * the authenticity + * and integrity of the credential data fields. + * @throws UnknownAuthenticationKeyException If the given authentication key is not recognized. + */ + public void storeStaticAuthenticationData( + @NonNull X509Certificate authenticationKey, + @NonNull Instant expirationDate, + @NonNull byte[] staticAuthData) + throws UnknownAuthenticationKeyException { + throw new UnsupportedOperationException(); + } + /** * Get the number of times the dynamic authentication keys have been used. * * @return int array of dynamic authentication key usage counts. */ public @NonNull abstract int[] getAuthenticationDataUsageCount(); + + /** + * Proves ownership of a credential. + * + *

This method returns a COSE_Sign1 data structure signed by the CredentialKey + * with payload set to {@code ProofOfDeletion} as defined below.

+ * + *

The returned CBOR is the following:

+ *
+     *     ProofOfOwnership = [
+     *          "ProofOfOwnership",           ; tstr
+     *          tstr,                         ; DocType
+     *          bstr,                         ; Challenge
+     *          bool                          ; true if this is a test credential, should
+     *                                        ; always be false.
+     *      ]
+     * 
+ * + *

This is only implemented in feature version 202101 or later. If not implemented, the call + * fails with {@link UnsupportedOperationException}. See + * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known + * feature versions. + * + * @param challenge is a non-empty byte array whose contents should be unique, fresh and + * provided by the issuing authority. The value provided is embedded in the + * generated CBOR and enables the issuing authority to verify that the + * returned proof is fresh. + * @return the COSE_Sign1 data structure above + */ + public @NonNull byte[] proveOwnership(@NonNull byte[] challenge) { + throw new UnsupportedOperationException(); + } + + /** + * Deletes a credential. + * + *

This method returns a COSE_Sign1 data structure signed by the CredentialKey + * with payload set to {@code ProofOfDeletion} as defined below.

+ * + *
+     *     ProofOfDeletion = [
+     *          "ProofOfDeletion",            ; tstr
+     *          tstr,                         ; DocType
+     *          bstr,                         ; Challenge
+     *          bool                          ; true if this is a test credential, should
+     *                                        ; always be false.
+     *      ]
+     * 
+ * + *

This is only implemented in feature version 202101 or later. If not implemented, the call + * fails with {@link UnsupportedOperationException}. See + * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known + * feature versions. + * + * @param challenge is a non-empty byte array whose contents should be unique, fresh and + * provided by the issuing authority. The value provided is embedded in the + * generated CBOR and enables the issuing authority to verify that the + * returned proof is fresh. + * @return the COSE_Sign1 data structure above + */ + public @NonNull byte[] delete(@NonNull byte[] challenge) { + throw new UnsupportedOperationException(); + } + + /** + * Updates the credential with new access control profiles and data items. + * + *

This method is similar to + * {@link WritableIdentityCredential#personalize(PersonalizationData)} except that it operates + * on an existing credential, see the documentation for that method for the format of the + * returned data. + * + *

If this call succeeds an side-effect is that all dynamic authentication keys for the + * credential are deleted. The application will need to use + * {@link #getAuthKeysNeedingCertification()} to generate replacement keys and return + * them for issuer certification. + * + *

This is only implemented in feature version 202101 or later. If not implemented, the call + * fails with {@link UnsupportedOperationException}. See + * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known + * feature versions. + * + * @param personalizationData The data to update, including access control profiles + * and data elements and their values, grouped into namespaces. + * @return A COSE_Sign1 data structure, see above. + */ + public @NonNull byte[] update(@NonNull PersonalizationData personalizationData) { + throw new UnsupportedOperationException(); + } } diff --git a/identity/java/android/security/identity/IdentityCredentialStore.java b/identity/java/android/security/identity/IdentityCredentialStore.java index 3843d9279900..6ccd0e892141 100644 --- a/identity/java/android/security/identity/IdentityCredentialStore.java +++ b/identity/java/android/security/identity/IdentityCredentialStore.java @@ -72,6 +72,17 @@ import java.lang.annotation.RetentionPolicy; *

Credentials provisioned to the direct access store should always use reader * authentication to protect data elements. The reason for this is user authentication or user * approval of data release is not possible when the device is off. + * + *

The Identity Credential API is designed to be able to evolve and change over time + * but still provide 100% backwards compatibility. This is complicated by the fact that + * there may be a version skew between the API used by the application and the version + * implemented in secure hardware. To solve this problem, the API provides for a way + * for the application to query which feature version the hardware implements (if any + * at all) using + * {@link android.content.pm#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} and + * {@link android.content.pm#FEATURE_IDENTITY_CREDENTIAL_HARDWARE_DIRECT_ACCESS}. + * Methods which only work on certain feature versions are clearly documented as + * such. */ public abstract class IdentityCredentialStore { IdentityCredentialStore() {} @@ -193,7 +204,9 @@ public abstract class IdentityCredentialStore { * @param credentialName the name of the credential to delete. * @return {@code null} if the credential was not found, the COSE_Sign1 data structure above * if the credential was found and deleted. + * @deprecated Use {@link IdentityCredential#delete(byte[])} instead. */ + @Deprecated public abstract @Nullable byte[] deleteCredentialByName(@NonNull String credentialName); /** @hide */ @@ -201,5 +214,4 @@ public abstract class IdentityCredentialStore { @Retention(RetentionPolicy.SOURCE) public @interface Ciphersuite { } - } -- cgit v1.2.3-59-g8ed1b